C9HF17O5S — CID 175973628
1,2,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonate (PubChem CID 175973628) has the molecular formula C9HF17O5S and a molecular weight of 544.14 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonate.
| Compound Name | 1,2,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonate |
|---|---|
| PubChem CID | 175973628 |
| Molecular Formula | C9HF17O5S |
| Molecular Weight | 544.14 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | 1,2,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonate |
| SMILES | O=S(=O)(OC(F)C(F)(F)F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9HF17O5S/c10-1(11)2(12)29-7(21,22)5(17,6(18,19)20)31-8(23,24)9(25,26)32(27,28)30-3(13)4(14,15)16/h3H |
| InChIKey | WGIVLBWUYHKTAS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.14 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|