C13H7F19O — CID 139918549
2-[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl]oxirane (PubChem CID 139918549) has the molecular formula C13H7F19O and a molecular weight of 540.16 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl]oxirane.
| Compound Name | 2-[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl]oxirane |
|---|---|
| PubChem CID | 139918549 |
| Molecular Formula | C13H7F19O |
| Molecular Weight | 540.16 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 2-[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl]oxirane |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC1CO1 |
| InChI | InChI=1S/C13H7F19O/c14-5(15,2-1-4-3-33-4)7(17,18)9(21,22)11(25,26)10(23,24)8(19,20)6(16,12(27,28)29)13(30,31)32/h4H,1-3H2 |
| InChIKey | OOLVYPWTJORFFC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.16 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|