C10H17F7O4P+ — CID 161399800
2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethoxy-methyl-oxophosphanium;methane (PubChem CID 161399800) has the molecular formula C10H17F7O4P+ and a molecular weight of 365.20 g/mol. Its IUPAC name is 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethoxy-methyl-oxophosphanium;methane.
| Compound Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethoxy-methyl-oxophosphanium;methane |
|---|---|
| PubChem CID | 161399800 |
| Molecular Formula | C10H17F7O4P+ |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethoxy-methyl-oxophosphanium;methane |
| SMILES | C.C[P+](=O)OCCOCCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F7O4P.CH4/c1-21(17)20-5-4-18-2-3-19-6-7(10,11)8(12,13)9(14,15)16;/h2-6H2,1H3;1H4/q+1; |
| InChIKey | CQQVAZKWDRUEJO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|