C9H11F9O2P+ — CID 58225249
methyl-oxo-[6,6,6-trifluoro-4,4-bis(trifluoromethyl)hexoxy]phosphanium (PubChem CID 58225249) has the molecular formula C9H11F9O2P+ and a molecular weight of 353.14 g/mol. Its IUPAC name is methyl-oxo-[6,6,6-trifluoro-4,4-bis(trifluoromethyl)hexoxy]phosphanium.
| Compound Name | methyl-oxo-[6,6,6-trifluoro-4,4-bis(trifluoromethyl)hexoxy]phosphanium |
|---|---|
| PubChem CID | 58225249 |
| Molecular Formula | C9H11F9O2P+ |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | methyl-oxo-[6,6,6-trifluoro-4,4-bis(trifluoromethyl)hexoxy]phosphanium |
| SMILES | C[P+](=O)OCCCC(CC(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O2P/c1-21(19)20-4-2-3-6(8(13,14)15,9(16,17)18)5-7(10,11)12/h2-5H2,1H3/q+1 |
| InChIKey | SUDJMMNHLGKXHS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|