C8H8F10O3PS+ — CID 139483955
methyl-oxo-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]phosphanium (PubChem CID 139483955) has the molecular formula C8H8F10O3PS+ and a molecular weight of 405.17 g/mol. Its IUPAC name is methyl-oxo-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]phosphanium.
| Compound Name | methyl-oxo-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]phosphanium |
|---|---|
| PubChem CID | 139483955 |
| Molecular Formula | C8H8F10O3PS+ |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | methyl-oxo-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]phosphanium |
| SMILES | C[P+](=O)OCCSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10O3PS/c1-22(19)20-2-3-23-5(10,11)4(9)21-8(17,18)6(12,13)7(14,15)16/h4H,2-3H2,1H3/q+1 |
| InChIKey | WGFRMMNQTJHDOV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|