C18H11F20O9S3- — CID 153429855
(E)-1,4-dioxo-1,4-bis[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]but-2-ene-2-sulfonate (PubChem CID 153429855) has the molecular formula C18H11F20O9S3- and a molecular weight of 847.44 g/mol. Its IUPAC name is (E)-1,4-dioxo-1,4-bis[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]but-2-ene-2-sulfonate.
| Compound Name | (E)-1,4-dioxo-1,4-bis[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]but-2-ene-2-sulfonate |
|---|---|
| PubChem CID | 153429855 |
| Molecular Formula | C18H11F20O9S3- |
| Molecular Weight | 847.44 g/mol |
| Exact Mass | 846.93 |
| IUPAC Name | (E)-1,4-dioxo-1,4-bis[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]but-2-ene-2-sulfonate |
| SMILES | O=C(/C=C(\C(=O)OCCSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)[O-])OCCSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H12F20O9S3/c19-9(46-17(35,36)13(25,26)15(29,30)31)11(21,22)48-3-1-44-7(39)5-6(50(41,42)43)8(40)45-2-4-49-12(23,24)10(20)47-18(37,38)14(27,28)16(32,33)34/h5,9-10H,1-4H2,(H,41,42,43)/p-1/b6-5+ |
| InChIKey | ORDJYHOPMJWTSG-AATRIKPKSA-M |
| XLogP | 6.36 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|