C9H15F5NO2+ — CID 163324327
carboxymethyl-dimethyl-(4,4,5,5,5-pentafluoropentyl)azanium (PubChem CID 163324327) has the molecular formula C9H15F5NO2+ and a molecular weight of 264.21 g/mol. Its IUPAC name is carboxymethyl-dimethyl-(4,4,5,5,5-pentafluoropentyl)azanium.
| Compound Name | carboxymethyl-dimethyl-(4,4,5,5,5-pentafluoropentyl)azanium |
|---|---|
| PubChem CID | 163324327 |
| Molecular Formula | C9H15F5NO2+ |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | carboxymethyl-dimethyl-(4,4,5,5,5-pentafluoropentyl)azanium |
| SMILES | C[N+](C)(CCCC(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C9H14F5NO2/c1-15(2,6-7(16)17)5-3-4-8(10,11)9(12,13)14/h3-6H2,1-2H3/p+1 |
| InChIKey | OTIWXZROVPCJSY-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|