C7H17NO6S — CID 7157234
(2R)-3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonic acid (PubChem CID 7157234) has the molecular formula C7H17NO6S and a molecular weight of 243.28 g/mol. Its IUPAC name is (2R)-3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | (2R)-3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 7157234 |
| Molecular Formula | C7H17NO6S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (2R)-3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C[C@H](O)CN(CCO)CCO |
| InChI | InChI=1S/C7H17NO6S/c9-3-1-8(2-4-10)5-7(11)6-15(12,13)14/h7,9-11H,1-6H2,(H,12,13,14)/t7-/m1/s1 |
| InChIKey | XCBLFURAFHFFJF-SSDOTTSWSA-N |
| XLogP | -2.48 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|