C9H23NO5S — CID 175446284
N,N-diethylethanamine;2,3-dihydroxypropane-1-sulfonic acid (PubChem CID 175446284) has the molecular formula C9H23NO5S and a molecular weight of 257.35 g/mol. Its IUPAC name is N,N-diethylethanamine;2,3-dihydroxypropane-1-sulfonic acid.
| Compound Name | N,N-diethylethanamine;2,3-dihydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 175446284 |
| Molecular Formula | C9H23NO5S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N,N-diethylethanamine;2,3-dihydroxypropane-1-sulfonic acid |
| SMILES | CCN(CC)CC.O=S(=O)(O)CC(O)CO |
| InChI | InChI=1S/C6H15N.C3H8O5S/c1-4-7(5-2)6-3;4-1-3(5)2-9(6,7)8/h4-6H2,1-3H3;3-5H,1-2H2,(H,6,7,8) |
| InChIKey | RVHSEELNMWTWSG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|