C7H18N2O6S2 — CID 158973571
3-[3-aminopropyl(methylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid (PubChem CID 158973571) has the molecular formula C7H18N2O6S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[3-aminopropyl(methylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | 3-[3-aminopropyl(methylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 158973571 |
| Molecular Formula | C7H18N2O6S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-[3-aminopropyl(methylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid |
| SMILES | CS(=O)(=O)N(CCCN)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C7H18N2O6S2/c1-16(11,12)9(4-2-3-8)5-7(10)6-17(13,14)15/h7,10H,2-6,8H2,1H3,(H,13,14,15) |
| InChIKey | LROUZQGWKLXJHB-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|