2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate

C9H24N2O6S — CID 174060252

IUPAC2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate
SMILESCCN(CCCN)CC(O)O.CCOS(=O)(=O)O
InChIInChI=1S/C7H18N2O2.C2H6O4S/c1-2-9(5-3-4-8)6-7(10)11;1-2-6-7(3,4)5/h7,10-11H,2-6,8H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeySLJNNVQLNSDPCC-UHFFFAOYSA-N
MW288.37 g/mol
LogP-1.21
Rot. Bonds8

About 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate

2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate (PubChem CID 174060252) has the molecular formula C9H24N2O6S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate.

Molecular Properties

Compound Name2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate
PubChem CID174060252
Molecular FormulaC9H24N2O6S
Molecular Weight288.37 g/mol
Exact Mass288.14
IUPAC Name2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate
SMILESCCN(CCCN)CC(O)O.CCOS(=O)(=O)O
InChIInChI=1S/C7H18N2O2.C2H6O4S/c1-2-9(5-3-4-8)6-7(10)11;1-2-6-7(3,4)5/h7,10-11H,2-6,8H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeySLJNNVQLNSDPCC-UHFFFAOYSA-N
XLogP-1.21
TPSA133.32 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.37
LogP ≤ 5-1.21
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate?
The IUPAC name of 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate (CID 174060252) is 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate.
What is the SMILES notation for 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate?
The canonical SMILES for 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate is CCN(CCCN)CC(O)O.CCOS(=O)(=O)O.
What is the InChIKey of 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate?
The InChIKey is SLJNNVQLNSDPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O2.C2H6O4S/c1-2-9(5-3-4-8)6-7(10)11;1-2-6-7(3,4)5/h7,10-11H,2-6,8H2,1H3;2H2,1H3,(H,3,4,5).
What are the key properties of 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate?
2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate has a molecular weight of 288.37 g/mol, XLogP of -1.21, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate is sourced from PubChem (CID 174060252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).