C9H24N2O6S — CID 174060252
2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate (PubChem CID 174060252) has the molecular formula C9H24N2O6S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate.
| Compound Name | 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 174060252 |
| Molecular Formula | C9H24N2O6S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[3-aminopropyl(ethyl)amino]ethane-1,1-diol;ethyl hydrogen sulfate |
| SMILES | CCN(CCCN)CC(O)O.CCOS(=O)(=O)O |
| InChI | InChI=1S/C7H18N2O2.C2H6O4S/c1-2-9(5-3-4-8)6-7(10)11;1-2-6-7(3,4)5/h7,10-11H,2-6,8H2,1H3;2H2,1H3,(H,3,4,5) |
| InChIKey | SLJNNVQLNSDPCC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|