C25H50N2O6S — CID 98048676
(2R)-2-hydroxy-3-[2-hydroxyethyl-[2-[[(E)-octadec-9-enoyl]amino]ethyl]amino]propane-1-sulfonic acid (PubChem CID 98048676) has the molecular formula C25H50N2O6S and a molecular weight of 506.75 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[2-hydroxyethyl-[2-[[(E)-octadec-9-enoyl]amino]ethyl]amino]propane-1-sulfonic acid.
| Compound Name | (2R)-2-hydroxy-3-[2-hydroxyethyl-[2-[[(E)-octadec-9-enoyl]amino]ethyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 98048676 |
| Molecular Formula | C25H50N2O6S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (2R)-2-hydroxy-3-[2-hydroxyethyl-[2-[[(E)-octadec-9-enoyl]amino]ethyl]amino]propane-1-sulfonic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NCCN(CCO)C[C@@H](O)CS(=O)(=O)O |
| InChI | InChI=1S/C25H50N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(30)26-18-19-27(20-21-28)22-24(29)23-34(31,32)33/h9-10,24,28-29H,2-8,11-23H2,1H3,(H,26,30)(H,31,32,33)/b10-9+/t24-/m1/s1 |
| InChIKey | GDVGKWLZJUOVAW-HBRDYDSTSA-N |
| XLogP | 3.68 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|