C19H38N2O5S — CID 137426918
3-[3-[[(E)-dodec-9-enoyl]amino]propyl-methylamino]-2-hydroxypropane-1-sulfonic acid (PubChem CID 137426918) has the molecular formula C19H38N2O5S and a molecular weight of 406.59 g/mol. Its IUPAC name is 3-[3-[[(E)-dodec-9-enoyl]amino]propyl-methylamino]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | 3-[3-[[(E)-dodec-9-enoyl]amino]propyl-methylamino]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 137426918 |
| Molecular Formula | C19H38N2O5S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 3-[3-[[(E)-dodec-9-enoyl]amino]propyl-methylamino]-2-hydroxypropane-1-sulfonic acid |
| SMILES | CC/C=C/CCCCCCCC(=O)NCCCN(C)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C19H38N2O5S/c1-3-4-5-6-7-8-9-10-11-13-19(23)20-14-12-15-21(2)16-18(22)17-27(24,25)26/h4-5,18,22H,3,6-17H2,1-2H3,(H,20,23)(H,24,25,26)/b5-4+ |
| InChIKey | TUWKWHFABLFOMN-SNAWJCMRSA-N |
| XLogP | 2.37 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|