C20H11Cl2F6NO2S — CID 91309099
N-(3,5-dichlorophenyl)-N-phenyl-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 91309099) has the molecular formula C20H11Cl2F6NO2S and a molecular weight of 514.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-N-phenyl-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-N-phenyl-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91309099 |
| Molecular Formula | C20H11Cl2F6NO2S |
| Molecular Weight | 514.27 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | N-(3,5-dichlorophenyl)-N-phenyl-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(c1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H11Cl2F6NO2S/c21-14-9-15(22)11-17(10-14)29(16-4-2-1-3-5-16)32(30,31)18-7-12(19(23,24)25)6-13(8-18)20(26,27)28/h1-11H |
| InChIKey | BISHITKFXMVWCM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.27 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |