C16H8F12N2O4S2 — CID 172578620
N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3,5-bis(trifluoromethyl)benzenesulfonohydrazide (PubChem CID 172578620) has the molecular formula C16H8F12N2O4S2 and a molecular weight of 584.36 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3,5-bis(trifluoromethyl)benzenesulfonohydrazide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3,5-bis(trifluoromethyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 172578620 |
| Molecular Formula | C16H8F12N2O4S2 |
| Molecular Weight | 584.36 g/mol |
| Exact Mass | 583.97 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3,5-bis(trifluoromethyl)benzenesulfonohydrazide |
| SMILES | NN(S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F12N2O4S2/c17-13(18,19)7-1-8(14(20,21)22)4-11(3-7)35(31,32)30(29)36(33,34)12-5-9(15(23,24)25)2-10(6-12)16(26,27)28/h1-6H,29H2 |
| InChIKey | SMGAIOOHDYYIDT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|