C8H8F3NO3S — CID 134627197
3-methoxy-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 134627197) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is 3-methoxy-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-methoxy-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134627197 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-methoxy-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc(C(F)(F)F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H8F3NO3S/c1-15-6-2-5(8(9,10)11)3-7(4-6)16(12,13)14/h2-4H,1H3,(H2,12,13,14) |
| InChIKey | MJXSZWFAWVZLNT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |