C9H8F5NO2S — CID 143940241
3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 143940241) has the molecular formula C9H8F5NO2S and a molecular weight of 289.23 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143940241 |
| Molecular Formula | C9H8F5NO2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(F)(F)c1cc(C(F)(F)F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H8F5NO2S/c1-8(10,11)5-2-6(9(12,13)14)4-7(3-5)18(15,16)17/h2-4H,1H3,(H2,15,16,17) |
| InChIKey | PRDSPKKPDAPJIS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |