C10H7F7O2S — CID 146412406
1-(1-fluoroethylsulfonyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 146412406) has the molecular formula C10H7F7O2S and a molecular weight of 324.22 g/mol. Its IUPAC name is 1-(1-fluoroethylsulfonyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(1-fluoroethylsulfonyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146412406 |
| Molecular Formula | C10H7F7O2S |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-(1-fluoroethylsulfonyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CC(F)S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F7O2S/c1-5(11)20(18,19)8-3-6(9(12,13)14)2-7(4-8)10(15,16)17/h2-5H,1H3 |
| InChIKey | PKGRQEKILVPDAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |