C13H13F6NO2S — CID 162538186
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine (PubChem CID 162538186) has the molecular formula C13H13F6NO2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine |
|---|---|
| PubChem CID | 162538186 |
| Molecular Formula | C13H13F6NO2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine |
| SMILES | CC(C)C1CN1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO2S/c1-7(2)11-6-20(11)23(21,22)10-4-8(12(14,15)16)3-9(5-10)13(17,18)19/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | QKSUFGAUVANUAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|