About 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine (PubChem CID 162538186) has the molecular formula C13H13F6NO2S
and a molecular weight of 361.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine |
| PubChem CID | 162538186 |
| Molecular Formula | C13H13F6NO2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine |
| SMILES | CC(C)C1CN1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO2S/c1-7(2)11-6-20(11)23(21,22)10-4-8(12(14,15)16)3-9(5-10)13(17,18)19/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | QKSUFGAUVANUAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine (CID 162538186) is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine is CC(C)C1CN1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine?
The InChIKey is QKSUFGAUVANUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F6NO2S/c1-7(2)11-6-20(11)23(21,22)10-4-8(12(14,15)16)3-9(5-10)13(17,18)19/h3-5,7,11H,6H2,1-2H3.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine?
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine has a molecular weight of 361.31 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-propan-2-ylaziridine is sourced from PubChem (CID 162538186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).