C12H14ClF3N2O2S — CID 120708063
1-[3-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine (PubChem CID 120708063) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 120708063 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine |
| SMILES | CC1CNCCN1S(=O)(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c1-8-7-17-2-3-18(8)21(19,20)11-5-9(12(14,15)16)4-10(13)6-11/h4-6,8,17H,2-3,7H2,1H3 |
| InChIKey | BNMBRCVEKSPNFG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |