C13H10F6O2S — CID 132553792
1-(3-methylbuta-1,3-dien-2-ylsulfonyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 132553792) has the molecular formula C13H10F6O2S and a molecular weight of 344.28 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-ylsulfonyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(3-methylbuta-1,3-dien-2-ylsulfonyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 132553792 |
| Molecular Formula | C13H10F6O2S |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-ylsulfonyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | C=C(C)C(=C)S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F6O2S/c1-7(2)8(3)22(20,21)11-5-9(12(14,15)16)4-10(6-11)13(17,18)19/h4-6H,1,3H2,2H3 |
| InChIKey | UFBLGCWKYSZLSD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|