C12H8F6O2 — CID 131847273
1-[3,5-bis(trifluoromethyl)phenyl]ethenyl acetate (PubChem CID 131847273) has the molecular formula C12H8F6O2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl acetate.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl acetate |
|---|---|
| PubChem CID | 131847273 |
| Molecular Formula | C12H8F6O2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl acetate |
| SMILES | C=C(OC(C)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F6O2/c1-6(20-7(2)19)8-3-9(11(13,14)15)5-10(4-8)12(16,17)18/h3-5H,1H2,2H3 |
| InChIKey | MDQROGUVYJPAJN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|