C19H14F6INO — CID 163639857
1-[3,5-bis(trifluoromethyl)phenyl]ethenyl 5-iodo-N,2-dimethylbenzenecarboximidate (PubChem CID 163639857) has the molecular formula C19H14F6INO and a molecular weight of 513.22 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl 5-iodo-N,2-dimethylbenzenecarboximidate.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl 5-iodo-N,2-dimethylbenzenecarboximidate |
|---|---|
| PubChem CID | 163639857 |
| Molecular Formula | C19H14F6INO |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethenyl 5-iodo-N,2-dimethylbenzenecarboximidate |
| SMILES | C=C(O/C(=N/C)c1cc(I)ccc1C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F6INO/c1-10-4-5-15(26)9-16(10)17(27-3)28-11(2)12-6-13(18(20,21)22)8-14(7-12)19(23,24)25/h4-9H,2H2,1,3H3/b27-17+ |
| InChIKey | IDHUCJLLBFQDIC-WPWMEQJKSA-N |
| XLogP | 6.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|