C22H19F3N2O3S2 — CID 126268693
2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 126268693) has the molecular formula C22H19F3N2O3S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126268693 |
| Molecular Formula | C22H19F3N2O3S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19F3N2O3S2/c1-31-20-13-6-5-12-19(20)26-21(28)15-27(32(29,30)18-10-3-2-4-11-18)17-9-7-8-16(14-17)22(23,24)25/h2-14H,15H2,1H3,(H,26,28) |
| InChIKey | HPRJFOZXDUFJRY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |