C13H18ClNO5S — CID 50895054
ethyl 2-(5-chloro-N-ethylsulfonyl-2-methoxyanilino)acetate (PubChem CID 50895054) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is ethyl 2-(5-chloro-N-ethylsulfonyl-2-methoxyanilino)acetate.
| Compound Name | ethyl 2-(5-chloro-N-ethylsulfonyl-2-methoxyanilino)acetate |
|---|---|
| PubChem CID | 50895054 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | ethyl 2-(5-chloro-N-ethylsulfonyl-2-methoxyanilino)acetate |
| SMILES | CCOC(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)CC |
| InChI | InChI=1S/C13H18ClNO5S/c1-4-20-13(16)9-15(21(17,18)5-2)11-8-10(14)6-7-12(11)19-3/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | DGYXBMYMJNXZAH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |