C25H23N3O6S3 — CID 4850525
3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4850525) has the molecular formula C25H23N3O6S3 and a molecular weight of 557.68 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4850525 |
| Molecular Formula | C25H23N3O6S3 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1cccc(C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)c1 |
| InChI | InChI=1S/C25H23N3O6S3/c1-4-14-28(21-10-5-6-11-22(21)34-2)37(32,33)19-9-7-8-17(15-19)24(29)27-25-26-20-13-12-18(36(3,30)31)16-23(20)35-25/h4-13,15-16H,1,14H2,2-3H3,(H,26,27,29) |
| InChIKey | JTFUIKVUKNKYGE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|