C23H27ClN2O6S — CID 55366522
[1-oxo-1-(propan-2-ylamino)propan-2-yl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 55366522) has the molecular formula C23H27ClN2O6S and a molecular weight of 495.00 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylamino)propan-2-yl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 55366522 |
| Molecular Formula | C23H27ClN2O6S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OC(C)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C23H27ClN2O6S/c1-6-13-26(17-7-9-18(31-5)10-8-17)33(29,30)19-11-12-21(24)20(14-19)23(28)32-16(4)22(27)25-15(2)3/h6-12,14-16H,1,13H2,2-5H3,(H,25,27) |
| InChIKey | BILCLHCDSODYPK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|