C26H27ClN2O6S2 — CID 2415154
ethyl 2-[[2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 2415154) has the molecular formula C26H27ClN2O6S2 and a molecular weight of 563.10 g/mol. Its IUPAC name is ethyl 2-[[2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2415154 |
| Molecular Formula | C26H27ClN2O6S2 |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | ethyl 2-[[2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | C=CCN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2sc(C)c(C)c2C(=O)OCC)c1 |
| InChI | InChI=1S/C26H27ClN2O6S2/c1-6-14-29(18-8-10-19(34-5)11-9-18)37(32,33)20-12-13-22(27)21(15-20)24(30)28-25-23(26(31)35-7-2)16(3)17(4)36-25/h6,8-13,15H,1,7,14H2,2-5H3,(H,28,30) |
| InChIKey | UZVIJDYINZNWKT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|