C24H20ClNO5S — CID 2595941
[2-(4-chlorophenyl)-2-oxoethyl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 2595941) has the molecular formula C24H20ClNO5S and a molecular weight of 469.95 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2595941 |
| Molecular Formula | C24H20ClNO5S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H20ClNO5S/c1-2-15-26(21-8-4-3-5-9-21)32(29,30)22-10-6-7-19(16-22)24(28)31-17-23(27)18-11-13-20(25)14-12-18/h2-14,16H,1,15,17H2 |
| InChIKey | UXGONUGYUXRWED-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|