C22H19NO5S2 — CID 2596034
(2-oxo-2-thiophen-2-ylethyl) 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 2596034) has the molecular formula C22H19NO5S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2596034 |
| Molecular Formula | C22H19NO5S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H19NO5S2/c1-2-13-23(18-9-4-3-5-10-18)30(26,27)19-11-6-8-17(15-19)22(25)28-16-20(24)21-12-7-14-29-21/h2-12,14-15H,1,13,16H2 |
| InChIKey | LUYGPCHXFCLPIV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|