C18H14F2NO6- — CID 9447429
4-[(E)-3-[2-(difluoromethoxy)-5-methylphenyl]-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate (PubChem CID 9447429) has the molecular formula C18H14F2NO6- and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-[(E)-3-[2-(difluoromethoxy)-5-methylphenyl]-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-3-[2-(difluoromethoxy)-5-methylphenyl]-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 9447429 |
| Molecular Formula | C18H14F2NO6- |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[(E)-3-[2-(difluoromethoxy)-5-methylphenyl]-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C/C(=O)c2cc(C)ccc2OC(F)F)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C18H15F2NO6/c1-10-3-6-15(27-18(19)20)12(7-10)14(22)5-4-11-8-13(21(24)25)17(23)16(9-11)26-2/h3-9,18,23H,1-2H3/p-1/b5-4+ |
| InChIKey | JGGGGFAYRYJQJS-SNAWJCMRSA-M |
| XLogP | 3.48 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|