About 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole
2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole (PubChem CID 4848954) has the molecular formula C20H12N2O4S
and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole |
| PubChem CID | 4848954 |
| Molecular Formula | C20H12N2O4S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole |
| SMILES | O=[N+]([O-])c1cc2c(cc1C=Cc1nc3c(ccc4ccccc43)s1)OCO2 |
| InChI | InChI=1S/C20H12N2O4S/c23-22(24)15-10-17-16(25-11-26-17)9-13(15)6-8-19-21-20-14-4-2-1-3-12(14)5-7-18(20)27-19/h1-10H,11H2 |
| InChIKey | ROWOKPIYOVYKIY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole?
The IUPAC name of 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole (CID 4848954) is 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole.
What is the SMILES notation for 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole?
The canonical SMILES for 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole is O=[N+]([O-])c1cc2c(cc1C=Cc1nc3c(ccc4ccccc43)s1)OCO2.
What is the InChIKey of 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole?
The InChIKey is ROWOKPIYOVYKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O4S/c23-22(24)15-10-17-16(25-11-26-17)9-13(15)6-8-19-21-20-14-4-2-1-3-12(14)5-7-18(20)27-19/h1-10H,11H2.
What are the key properties of 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole?
2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole has a molecular weight of 376.39 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]benzo[e][1,3]benzothiazole is sourced from PubChem (CID 4848954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).