C23H19N3O2S — CID 6107412
2-[(E)-2-(3-nitro-4-pyrrolidin-1-ylphenyl)ethenyl]benzo[e][1,3]benzothiazole (PubChem CID 6107412) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[(E)-2-(3-nitro-4-pyrrolidin-1-ylphenyl)ethenyl]benzo[e][1,3]benzothiazole.
| Compound Name | 2-[(E)-2-(3-nitro-4-pyrrolidin-1-ylphenyl)ethenyl]benzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 6107412 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[(E)-2-(3-nitro-4-pyrrolidin-1-ylphenyl)ethenyl]benzo[e][1,3]benzothiazole |
| SMILES | O=[N+]([O-])c1cc(/C=C/c2nc3c(ccc4ccccc43)s2)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H19N3O2S/c27-26(28)20-15-16(7-10-19(20)25-13-3-4-14-25)8-12-22-24-23-18-6-2-1-5-17(18)9-11-21(23)29-22/h1-2,5-12,15H,3-4,13-14H2/b12-8+ |
| InChIKey | LQDDULLLQXXTNQ-XYOKQWHBSA-N |
| XLogP | 6.13 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|