C22H16N4S — CID 4704660
2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile (PubChem CID 4704660) has the molecular formula C22H16N4S and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile.
| Compound Name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4704660 |
| Molecular Formula | C22H16N4S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(C(C#N)=Cc3cn[nH]c3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H16N4S/c1-15-7-9-16(10-8-15)20-14-27-22(25-20)18(12-23)11-19-13-24-26-21(19)17-5-3-2-4-6-17/h2-11,13-14H,1H3,(H,24,26) |
| InChIKey | OCAWCFBLPPNMRX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|