C17H14N4S — CID 19589788
(E)-3-(1,3-dimethylpyrazol-4-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 19589788) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is (E)-3-(1,3-dimethylpyrazol-4-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-dimethylpyrazol-4-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 19589788 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (E)-3-(1,3-dimethylpyrazol-4-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1nn(C)cc1/C=C(\C#N)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H14N4S/c1-12-15(10-21(2)20-12)8-14(9-18)17-19-16(11-22-17)13-6-4-3-5-7-13/h3-8,10-11H,1-2H3/b14-8+ |
| InChIKey | WLQDTRLDCJJIAQ-RIYZIHGNSA-N |
| XLogP | 3.92 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|