C32H22N4S — CID 6197071
(E)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(3-naphthalen-1-yl-1-phenylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 6197071) has the molecular formula C32H22N4S and a molecular weight of 494.62 g/mol. Its IUPAC name is (E)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(3-naphthalen-1-yl-1-phenylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(3-naphthalen-1-yl-1-phenylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6197071 |
| Molecular Formula | C32H22N4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (E)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(3-naphthalen-1-yl-1-phenylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(/C(C#N)=C/c3cn(-c4ccccc4)nc3-c3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C32H22N4S/c1-22-14-16-24(17-15-22)30-21-37-32(34-30)25(19-33)18-26-20-36(27-10-3-2-4-11-27)35-31(26)29-13-7-9-23-8-5-6-12-28(23)29/h2-18,20-21H,1H3/b25-18+ |
| InChIKey | WSJVJZMTBXIKEG-XIEYBQDHSA-N |
| XLogP | 8.19 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|