C22H17N3S — CID 91152797
(4-naphthalen-1-yl-1,3-thiazol-2-yl)-(3-phenylprop-2-enyl)diazene (PubChem CID 91152797) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is (4-naphthalen-1-yl-1,3-thiazol-2-yl)-(3-phenylprop-2-enyl)diazene.
| Compound Name | (4-naphthalen-1-yl-1,3-thiazol-2-yl)-(3-phenylprop-2-enyl)diazene |
|---|---|
| PubChem CID | 91152797 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (4-naphthalen-1-yl-1,3-thiazol-2-yl)-(3-phenylprop-2-enyl)diazene |
| SMILES | C(=Cc1ccccc1)C/N=N/c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C22H17N3S/c1-2-8-17(9-3-1)10-7-15-23-25-22-24-21(16-26-22)20-14-6-12-18-11-4-5-13-19(18)20/h1-14,16H,15H2/b10-7?,25-23+ |
| InChIKey | WYWDYXJPALOQFE-AYXVDKJSSA-N |
| XLogP | 6.76 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|