3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid

C16H12N2O2S — CID 63152488

IUPAC3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCc1cccnc1-c1nc(-c2cccc(C(=O)O)c2)cs1
InChIInChI=1S/C16H12N2O2S/c1-10-4-3-7-17-14(10)15-18-13(9-21-15)11-5-2-6-12(8-11)16(19)20/h2-9H,1H3,(H,19,20)
InChIKeyIOJGMSOMZWSOQU-UHFFFAOYSA-N
MW296.35 g/mol
LogP3.88
Rot. Bonds3

About 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid

3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 63152488) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid.

Molecular Properties

Compound Name3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid
PubChem CID63152488
Molecular FormulaC16H12N2O2S
Molecular Weight296.35 g/mol
Exact Mass296.06
IUPAC Name3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid
SMILESCc1cccnc1-c1nc(-c2cccc(C(=O)O)c2)cs1
InChIInChI=1S/C16H12N2O2S/c1-10-4-3-7-17-14(10)15-18-13(9-21-15)11-5-2-6-12(8-11)16(19)20/h2-9H,1H3,(H,19,20)
InChIKeyIOJGMSOMZWSOQU-UHFFFAOYSA-N
XLogP3.88
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.35
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid?
The IUPAC name of 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid (CID 63152488) is 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid.
What is the SMILES notation for 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid?
The canonical SMILES for 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid is Cc1cccnc1-c1nc(-c2cccc(C(=O)O)c2)cs1.
What is the InChIKey of 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid?
The InChIKey is IOJGMSOMZWSOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c1-10-4-3-7-17-14(10)15-18-13(9-21-15)11-5-2-6-12(8-11)16(19)20/h2-9H,1H3,(H,19,20).
What are the key properties of 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid?
3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid has a molecular weight of 296.35 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid is sourced from PubChem (CID 63152488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).