C16H12N2O2S — CID 63152488
3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid (PubChem CID 63152488) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 63152488 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[2-(3-methyl-2-pyridinyl)-1,3-thiazol-4-yl]benzoic acid |
| SMILES | Cc1cccnc1-c1nc(-c2cccc(C(=O)O)c2)cs1 |
| InChI | InChI=1S/C16H12N2O2S/c1-10-4-3-7-17-14(10)15-18-13(9-21-15)11-5-2-6-12(8-11)16(19)20/h2-9H,1H3,(H,19,20) |
| InChIKey | IOJGMSOMZWSOQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |