C10H12N4S2 — CID 22299017
(2-amino-1,3-thiazol-4-yl)-(4,6-dimethylpyrimidin-2-yl)methanethiol (PubChem CID 22299017) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)-(4,6-dimethylpyrimidin-2-yl)methanethiol.
| Compound Name | (2-amino-1,3-thiazol-4-yl)-(4,6-dimethylpyrimidin-2-yl)methanethiol |
|---|---|
| PubChem CID | 22299017 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)-(4,6-dimethylpyrimidin-2-yl)methanethiol |
| SMILES | Cc1cc(C)nc(C(S)c2csc(N)n2)n1 |
| InChI | InChI=1S/C10H12N4S2/c1-5-3-6(2)13-9(12-5)8(15)7-4-16-10(11)14-7/h3-4,8,15H,1-2H3,(H2,11,14) |
| InChIKey | JYIOBIZLMXDFST-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|