C11H10Cl2N2OS — CID 82022400
4-[1-(2,5-dichlorophenoxy)ethyl]-1,3-thiazol-2-amine (PubChem CID 82022400) has the molecular formula C11H10Cl2N2OS and a molecular weight of 289.19 g/mol. Its IUPAC name is 4-[1-(2,5-dichlorophenoxy)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[1-(2,5-dichlorophenoxy)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82022400 |
| Molecular Formula | C11H10Cl2N2OS |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 4-[1-(2,5-dichlorophenoxy)ethyl]-1,3-thiazol-2-amine |
| SMILES | CC(Oc1cc(Cl)ccc1Cl)c1csc(N)n1 |
| InChI | InChI=1S/C11H10Cl2N2OS/c1-6(9-5-17-11(14)15-9)16-10-4-7(12)2-3-8(10)13/h2-6H,1H3,(H2,14,15) |
| InChIKey | SHGOVNDUABMBQD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |