C10H18N2S — CID 130517444
4-(2,4-dimethylpentan-3-yl)-1,3-thiazol-2-amine (PubChem CID 130517444) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 4-(2,4-dimethylpentan-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethylpentan-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130517444 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-(2,4-dimethylpentan-3-yl)-1,3-thiazol-2-amine |
| SMILES | CC(C)C(c1csc(N)n1)C(C)C |
| InChI | InChI=1S/C10H18N2S/c1-6(2)9(7(3)4)8-5-13-10(11)12-8/h5-7,9H,1-4H3,(H2,11,12) |
| InChIKey | DFRLAWQOEBJSMC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |