C11H19BrN2OS — CID 87581796
1-bromo-3-methylbutan-2-one;4-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 87581796) has the molecular formula C11H19BrN2OS and a molecular weight of 307.26 g/mol. Its IUPAC name is 1-bromo-3-methylbutan-2-one;4-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 1-bromo-3-methylbutan-2-one;4-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87581796 |
| Molecular Formula | C11H19BrN2OS |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-bromo-3-methylbutan-2-one;4-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)C(=O)CBr.CC(C)c1csc(N)n1 |
| InChI | InChI=1S/C6H10N2S.C5H9BrO/c1-4(2)5-3-9-6(7)8-5;1-4(2)5(7)3-6/h3-4H,1-2H3,(H2,7,8);4H,3H2,1-2H3 |
| InChIKey | NTOBUUXIJVVDMN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|