C6H8N2O3S — CID 13490301
2-(2-amino-1,3-thiazol-4-yl)-2-methoxyacetic acid (PubChem CID 13490301) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyacetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyacetic acid |
|---|---|
| PubChem CID | 13490301 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyacetic acid |
| SMILES | COC(C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C6H8N2O3S/c1-11-4(5(9)10)3-2-12-6(7)8-3/h2,4H,1H3,(H2,7,8)(H,9,10) |
| InChIKey | RYSNAPCFBLXTMV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |