C5H6N2O2S — CID 54337328
2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyacetaldehyde (PubChem CID 54337328) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyacetaldehyde.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyacetaldehyde |
|---|---|
| PubChem CID | 54337328 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyacetaldehyde |
| SMILES | Nc1nc(C(O)C=O)cs1 |
| InChI | InChI=1S/C5H6N2O2S/c6-5-7-3(2-10-5)4(9)1-8/h1-2,4,9H,(H2,6,7) |
| InChIKey | JATZWCDMRPMTLK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|