C8H10N2O5S — CID 88674415
2-(2-amino-1,3-thiazol-4-yl)-3-hydroxypentanedioic acid (PubChem CID 88674415) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-3-hydroxypentanedioic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-3-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 88674415 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-3-hydroxypentanedioic acid |
| SMILES | Nc1nc(C(C(=O)O)C(O)CC(=O)O)cs1 |
| InChI | InChI=1S/C8H10N2O5S/c9-8-10-3(2-16-8)6(7(14)15)4(11)1-5(12)13/h2,4,6,11H,1H2,(H2,9,10)(H,12,13)(H,14,15) |
| InChIKey | RIEWSFRJPLNJSA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |