C7H9ClN2O2S — CID 174643774
chloro 2-(2-amino-1,3-thiazol-4-yl)butanoate (PubChem CID 174643774) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is chloro 2-(2-amino-1,3-thiazol-4-yl)butanoate.
| Compound Name | chloro 2-(2-amino-1,3-thiazol-4-yl)butanoate |
|---|---|
| PubChem CID | 174643774 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | chloro 2-(2-amino-1,3-thiazol-4-yl)butanoate |
| SMILES | CCC(C(=O)OCl)c1csc(N)n1 |
| InChI | InChI=1S/C7H9ClN2O2S/c1-2-4(6(11)12-8)5-3-13-7(9)10-5/h3-4H,2H2,1H3,(H2,9,10) |
| InChIKey | ZUBMBUNWTJIDTQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |