C12H19N3O4S — CID 174714544
acetic acid;ethyl 2-(2-carbamimidoyl-1,3-thiazol-4-yl)butanoate (PubChem CID 174714544) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is acetic acid;ethyl 2-(2-carbamimidoyl-1,3-thiazol-4-yl)butanoate.
| Compound Name | acetic acid;ethyl 2-(2-carbamimidoyl-1,3-thiazol-4-yl)butanoate |
|---|---|
| PubChem CID | 174714544 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | acetic acid;ethyl 2-(2-carbamimidoyl-1,3-thiazol-4-yl)butanoate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1nc(C(CC)C(=O)OCC)cs1 |
| InChI | InChI=1S/C10H15N3O2S.C2H4O2/c1-3-6(10(14)15-4-2)7-5-16-9(13-7)8(11)12;1-2(3)4/h5-6H,3-4H2,1-2H3,(H3,11,12);1H3,(H,3,4) |
| InChIKey | VICKGSIBXCYZRO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|