ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate

C13H15ClN2O2 — CID 169245308

IUPACethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate
SMILESCCOC(=O)C(CC)c1cn2cc(Cl)ccc2n1
InChIInChI=1S/C13H15ClN2O2/c1-3-10(13(17)18-4-2)11-8-16-7-9(14)5-6-12(16)15-11/h5-8,10H,3-4H2,1-2H3
InChIKeyCSEMLNZWMDIGDO-UHFFFAOYSA-N
MW266.73 g/mol
LogP3.04
Rot. Bonds4

About ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate

ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate (PubChem CID 169245308) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate.

Molecular Properties

Compound Nameethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate
PubChem CID169245308
Molecular FormulaC13H15ClN2O2
Molecular Weight266.73 g/mol
Exact Mass266.08
IUPAC Nameethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate
SMILESCCOC(=O)C(CC)c1cn2cc(Cl)ccc2n1
InChIInChI=1S/C13H15ClN2O2/c1-3-10(13(17)18-4-2)11-8-16-7-9(14)5-6-12(16)15-11/h5-8,10H,3-4H2,1-2H3
InChIKeyCSEMLNZWMDIGDO-UHFFFAOYSA-N
XLogP3.04
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.73
LogP ≤ 53.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate?
The IUPAC name of ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate (CID 169245308) is ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate.
What is the SMILES notation for ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate?
The canonical SMILES for ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate is CCOC(=O)C(CC)c1cn2cc(Cl)ccc2n1.
What is the InChIKey of ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate?
The InChIKey is CSEMLNZWMDIGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2/c1-3-10(13(17)18-4-2)11-8-16-7-9(14)5-6-12(16)15-11/h5-8,10H,3-4H2,1-2H3.
What are the key properties of ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate?
ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate has a molecular weight of 266.73 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)butanoate is sourced from PubChem (CID 169245308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).