C15H21ClN2O — CID 169245227
2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine;ethenoxyethane (PubChem CID 169245227) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine;ethenoxyethane.
| Compound Name | 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine;ethenoxyethane |
|---|---|
| PubChem CID | 169245227 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine;ethenoxyethane |
| SMILES | C=COCC.CCC(C)c1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C11H13ClN2.C4H8O/c1-3-8(2)10-7-14-6-9(12)4-5-11(14)13-10;1-3-5-4-2/h4-8H,3H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | HVADKXNLOJTBAB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|