C12H13ClN2O — CID 115405149
2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 115405149) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 115405149 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-butan-2-yl-6-chloroimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CCC(C)c1nc2ccc(Cl)cn2c1C=O |
| InChI | InChI=1S/C12H13ClN2O/c1-3-8(2)12-10(7-16)15-6-9(13)4-5-11(15)14-12/h4-8H,3H2,1-2H3 |
| InChIKey | VYUPIIALXBALFV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|